C13H9BrClF2N — CID 106943291
[2-(3-bromo-2,6-difluorophenyl)-5-chlorophenyl]methanamine (PubChem CID 106943291) has the molecular formula C13H9BrClF2N and a molecular weight of 332.58 g/mol. Its IUPAC name is [2-(3-bromo-2,6-difluorophenyl)-5-chlorophenyl]methanamine.
| Compound Name | [2-(3-bromo-2,6-difluorophenyl)-5-chlorophenyl]methanamine |
|---|---|
| PubChem CID | 106943291 |
| Molecular Formula | C13H9BrClF2N |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | [2-(3-bromo-2,6-difluorophenyl)-5-chlorophenyl]methanamine |
| SMILES | NCc1cc(Cl)ccc1-c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H9BrClF2N/c14-10-3-4-11(16)12(13(10)17)9-2-1-8(15)5-7(9)6-18/h1-5H,6,18H2 |
| InChIKey | RREREQBYXRBQJU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|