C12H3Cl5FNO2 — CID 134630100
1,2,3,4,5-pentachloro-6-(5-fluoro-2-nitrophenyl)benzene (PubChem CID 134630100) has the molecular formula C12H3Cl5FNO2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-(5-fluoro-2-nitrophenyl)benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-(5-fluoro-2-nitrophenyl)benzene |
|---|---|
| PubChem CID | 134630100 |
| Molecular Formula | C12H3Cl5FNO2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 386.86 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-(5-fluoro-2-nitrophenyl)benzene |
| SMILES | O=[N+]([O-])c1ccc(F)cc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H3Cl5FNO2/c13-8-7(9(14)11(16)12(17)10(8)15)5-3-4(18)1-2-6(5)19(20)21/h1-3H |
| InChIKey | AAPVKLZCPSPIFZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|