C8H3FIN3O2S — CID 63383357
2-(5-fluoro-2-nitrophenyl)-5-iodo-1,3,4-thiadiazole (PubChem CID 63383357) has the molecular formula C8H3FIN3O2S and a molecular weight of 351.10 g/mol. Its IUPAC name is 2-(5-fluoro-2-nitrophenyl)-5-iodo-1,3,4-thiadiazole.
| Compound Name | 2-(5-fluoro-2-nitrophenyl)-5-iodo-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63383357 |
| Molecular Formula | C8H3FIN3O2S |
| Molecular Weight | 351.10 g/mol |
| Exact Mass | 350.90 |
| IUPAC Name | 2-(5-fluoro-2-nitrophenyl)-5-iodo-1,3,4-thiadiazole |
| SMILES | O=[N+]([O-])c1ccc(F)cc1-c1nnc(I)s1 |
| InChI | InChI=1S/C8H3FIN3O2S/c9-4-1-2-6(13(14)15)5(3-4)7-11-12-8(10)16-7/h1-3H |
| InChIKey | JUMVDEGTCMOUPQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.10 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|