C12H2Cl8O — CID 102584207
2,3,6-trichloro-5-(2,3,4,5,6-pentachlorophenyl)phenol (PubChem CID 102584207) has the molecular formula C12H2Cl8O and a molecular weight of 445.77 g/mol. Its IUPAC name is 2,3,6-trichloro-5-(2,3,4,5,6-pentachlorophenyl)phenol.
| Compound Name | 2,3,6-trichloro-5-(2,3,4,5,6-pentachlorophenyl)phenol |
|---|---|
| PubChem CID | 102584207 |
| Molecular Formula | C12H2Cl8O |
| Molecular Weight | 445.77 g/mol |
| Exact Mass | 441.76 |
| IUPAC Name | 2,3,6-trichloro-5-(2,3,4,5,6-pentachlorophenyl)phenol |
| SMILES | Oc1c(Cl)c(Cl)cc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1Cl |
| InChI | InChI=1S/C12H2Cl8O/c13-3-1-2(5(14)12(21)6(3)15)4-7(16)9(18)11(20)10(19)8(4)17/h1,21H |
| InChIKey | VVIUHQTVYLPOSD-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.77 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|