C6H2Cl4O — CID 6028
2,3,4,6-tetrachlorophenol (PubChem CID 6028) has the molecular formula C6H2Cl4O and a molecular weight of 231.89 g/mol. Its IUPAC name is 2,3,4,6-tetrachlorophenol.
| Compound Name | 2,3,4,6-tetrachlorophenol |
|---|---|
| PubChem CID | 6028 |
| Molecular Formula | C6H2Cl4O |
| Molecular Weight | 231.89 g/mol |
| Exact Mass | 229.89 |
| IUPAC Name | 2,3,4,6-tetrachlorophenol |
| SMILES | Oc1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6H2Cl4O/c7-2-1-3(8)6(11)5(10)4(2)9/h1,11H |
| InChIKey | VGVRPFIJEJYOFN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|