C8H6ClN3O3S — CID 141007133
7-chloro-3-oxo-4H-quinoxaline-6-sulfonamide (PubChem CID 141007133) has the molecular formula C8H6ClN3O3S and a molecular weight of 259.67 g/mol. Its IUPAC name is 7-chloro-3-oxo-4H-quinoxaline-6-sulfonamide.
| Compound Name | 7-chloro-3-oxo-4H-quinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 141007133 |
| Molecular Formula | C8H6ClN3O3S |
| Molecular Weight | 259.67 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 7-chloro-3-oxo-4H-quinoxaline-6-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2[nH]c(=O)cnc2cc1Cl |
| InChI | InChI=1S/C8H6ClN3O3S/c9-4-1-5-6(12-8(13)3-11-5)2-7(4)16(10,14)15/h1-3H,(H,12,13)(H2,10,14,15) |
| InChIKey | VYIBPKQMBKSOMA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.67 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |