About 1H-quinoxalin-2-one;dihydrochloride
1H-quinoxalin-2-one;dihydrochloride (PubChem CID 141445979) has the molecular formula C8H8Cl2N2O
and a molecular weight of 219.07 g/mol. Its IUPAC name is 1H-quinoxalin-2-one;dihydrochloride.
Molecular Properties
| Compound Name | 1H-quinoxalin-2-one;dihydrochloride |
| PubChem CID | 141445979 |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 1H-quinoxalin-2-one;dihydrochloride |
| SMILES | Cl.Cl.O=c1cnc2ccccc2[nH]1 |
| InChI | InChI=1S/C8H6N2O.2ClH/c11-8-5-9-6-3-1-2-4-7(6)10-8;;/h1-5H,(H,10,11);2*1H |
| InChIKey | LKRWOWQKGSJJRG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-quinoxalin-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-quinoxalin-2-one;dihydrochloride?
The IUPAC name of 1H-quinoxalin-2-one;dihydrochloride (CID 141445979) is 1H-quinoxalin-2-one;dihydrochloride.
What is the SMILES notation for 1H-quinoxalin-2-one;dihydrochloride?
The canonical SMILES for 1H-quinoxalin-2-one;dihydrochloride is Cl.Cl.O=c1cnc2ccccc2[nH]1.
What is the InChIKey of 1H-quinoxalin-2-one;dihydrochloride?
The InChIKey is LKRWOWQKGSJJRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.2ClH/c11-8-5-9-6-3-1-2-4-7(6)10-8;;/h1-5H,(H,10,11);2*1H.
What are the key properties of 1H-quinoxalin-2-one;dihydrochloride?
1H-quinoxalin-2-one;dihydrochloride has a molecular weight of 219.07 g/mol, XLogP of 1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-quinoxalin-2-one;dihydrochloride is sourced from PubChem (CID 141445979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).