C6H7N5 — CID 13063643
3H-imidazo[4,5-c]pyridin-2-ylhydrazine (PubChem CID 13063643) has the molecular formula C6H7N5 and a molecular weight of 149.16 g/mol. Its IUPAC name is 3H-imidazo[4,5-c]pyridin-2-ylhydrazine.
| Compound Name | 3H-imidazo[4,5-c]pyridin-2-ylhydrazine |
|---|---|
| PubChem CID | 13063643 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 3H-imidazo[4,5-c]pyridin-2-ylhydrazine |
| SMILES | NNc1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C6H7N5/c7-11-6-9-4-1-2-8-3-5(4)10-6/h1-3H,7H2,(H2,9,10,11) |
| InChIKey | NKDSMRAHZKUCJO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|