C9H12N4 — CID 63268874
2-(3H-imidazo[4,5-c]pyridin-2-yl)propan-1-amine (PubChem CID 63268874) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-(3H-imidazo[4,5-c]pyridin-2-yl)propan-1-amine.
| Compound Name | 2-(3H-imidazo[4,5-c]pyridin-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 63268874 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-(3H-imidazo[4,5-c]pyridin-2-yl)propan-1-amine |
| SMILES | CC(CN)c1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C9H12N4/c1-6(4-10)9-12-7-2-3-11-5-8(7)13-9/h2-3,5-6H,4,10H2,1H3,(H,12,13) |
| InChIKey | LLFZWUUTXAOOLR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |