C13H19N3 — CID 63833124
2-(2,3,3-trimethylbutyl)-3H-imidazo[4,5-c]pyridine (PubChem CID 63833124) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-(2,3,3-trimethylbutyl)-3H-imidazo[4,5-c]pyridine.
| Compound Name | 2-(2,3,3-trimethylbutyl)-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 63833124 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-(2,3,3-trimethylbutyl)-3H-imidazo[4,5-c]pyridine |
| SMILES | CC(Cc1nc2ccncc2[nH]1)C(C)(C)C |
| InChI | InChI=1S/C13H19N3/c1-9(13(2,3)4)7-12-15-10-5-6-14-8-11(10)16-12/h5-6,8-9H,7H2,1-4H3,(H,15,16) |
| InChIKey | JNICRMXEFZLGKZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |