C10H12ClN3 — CID 94542564
(2S)-2-(4-chloro-1H-benzimidazol-2-yl)propan-1-amine (PubChem CID 94542564) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is (2S)-2-(4-chloro-1H-benzimidazol-2-yl)propan-1-amine.
| Compound Name | (2S)-2-(4-chloro-1H-benzimidazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 94542564 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (2S)-2-(4-chloro-1H-benzimidazol-2-yl)propan-1-amine |
| SMILES | C[C@@H](CN)c1nc2c(Cl)cccc2[nH]1 |
| InChI | InChI=1S/C10H12ClN3/c1-6(5-12)10-13-8-4-2-3-7(11)9(8)14-10/h2-4,6H,5,12H2,1H3,(H,13,14)/t6-/m0/s1 |
| InChIKey | GUXOEGUUXGBDKZ-LURJTMIESA-N |
| XLogP | 2.28 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |