C12H15ClN2 — CID 60978644
4-chloro-2-pentan-2-yl-1H-benzimidazole (PubChem CID 60978644) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 4-chloro-2-pentan-2-yl-1H-benzimidazole.
| Compound Name | 4-chloro-2-pentan-2-yl-1H-benzimidazole |
|---|---|
| PubChem CID | 60978644 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-chloro-2-pentan-2-yl-1H-benzimidazole |
| SMILES | CCCC(C)c1nc2c(Cl)cccc2[nH]1 |
| InChI | InChI=1S/C12H15ClN2/c1-3-5-8(2)12-14-10-7-4-6-9(13)11(10)15-12/h4,6-8H,3,5H2,1-2H3,(H,14,15) |
| InChIKey | NIORABFYBSBFKH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |