C10H13N3 — CID 83857640
(1S)-1-(4-methyl-1H-benzimidazol-2-yl)ethanamine (PubChem CID 83857640) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (1S)-1-(4-methyl-1H-benzimidazol-2-yl)ethanamine.
| Compound Name | (1S)-1-(4-methyl-1H-benzimidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 83857640 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | (1S)-1-(4-methyl-1H-benzimidazol-2-yl)ethanamine |
| SMILES | Cc1cccc2[nH]c([C@H](C)N)nc12 |
| InChI | InChI=1S/C10H13N3/c1-6-4-3-5-8-9(6)13-10(12-8)7(2)11/h3-5,7H,11H2,1-2H3,(H,12,13)/t7-/m0/s1 |
| InChIKey | NAONXKPGABABEQ-ZETCQYMHSA-N |
| XLogP | 1.89 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |