About 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride
4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride (PubChem CID 141030572) has the molecular formula C8H18Cl3N3O3
and a molecular weight of 310.61 g/mol. Its IUPAC name is 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride.
Molecular Properties
| Compound Name | 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride |
| PubChem CID | 141030572 |
| Molecular Formula | C8H18Cl3N3O3 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride |
| SMILES | Cc1cccc2[nH]c(N)nc12.Cl.Cl.Cl.O.O.O |
| InChI | InChI=1S/C8H9N3.3ClH.3H2O/c1-5-3-2-4-6-7(5)11-8(9)10-6;;;;;;/h2-4H,1H3,(H3,9,10,11);3*1H;3*1H2 |
| InChIKey | ZPTWOYXBLVESKG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride?
The IUPAC name of 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride (CID 141030572) is 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride.
What is the SMILES notation for 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride?
The canonical SMILES for 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride is Cc1cccc2[nH]c(N)nc12.Cl.Cl.Cl.O.O.O.
What is the InChIKey of 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride?
The InChIKey is ZPTWOYXBLVESKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3.3ClH.3H2O/c1-5-3-2-4-6-7(5)11-8(9)10-6;;;;;;/h2-4H,1H3,(H3,9,10,11);3*1H;3*1H2.
What are the key properties of 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride?
4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride has a molecular weight of 310.61 g/mol, XLogP of 0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1H-benzimidazol-2-amine;trihydrate;trihydrochloride is sourced from PubChem (CID 141030572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).