About 1H-benzimidazole-2,4-diamine;hydrochloride
1H-benzimidazole-2,4-diamine;hydrochloride (PubChem CID 169014009) has the molecular formula C7H9ClN4
and a molecular weight of 184.63 g/mol. Its IUPAC name is 1H-benzimidazole-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 1H-benzimidazole-2,4-diamine;hydrochloride |
| PubChem CID | 169014009 |
| Molecular Formula | C7H9ClN4 |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 1H-benzimidazole-2,4-diamine;hydrochloride |
| SMILES | Cl.Nc1nc2c(N)cccc2[nH]1 |
| InChI | InChI=1S/C7H8N4.ClH/c8-4-2-1-3-5-6(4)11-7(9)10-5;/h1-3H,8H2,(H3,9,10,11);1H |
| InChIKey | BMJASHOUXLMSEN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazole-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole-2,4-diamine;hydrochloride?
The IUPAC name of 1H-benzimidazole-2,4-diamine;hydrochloride (CID 169014009) is 1H-benzimidazole-2,4-diamine;hydrochloride.
What is the SMILES notation for 1H-benzimidazole-2,4-diamine;hydrochloride?
The canonical SMILES for 1H-benzimidazole-2,4-diamine;hydrochloride is Cl.Nc1nc2c(N)cccc2[nH]1.
What is the InChIKey of 1H-benzimidazole-2,4-diamine;hydrochloride?
The InChIKey is BMJASHOUXLMSEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4.ClH/c8-4-2-1-3-5-6(4)11-7(9)10-5;/h1-3H,8H2,(H3,9,10,11);1H.
What are the key properties of 1H-benzimidazole-2,4-diamine;hydrochloride?
1H-benzimidazole-2,4-diamine;hydrochloride has a molecular weight of 184.63 g/mol, XLogP of 1.15, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole-2,4-diamine;hydrochloride is sourced from PubChem (CID 169014009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).