C10H7F5N2 — CID 60979315
4-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole (PubChem CID 60979315) has the molecular formula C10H7F5N2 and a molecular weight of 250.17 g/mol. Its IUPAC name is 4-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole.
| Compound Name | 4-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 60979315 |
| Molecular Formula | C10H7F5N2 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 4-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
| SMILES | Cc1cccc2[nH]c(C(F)(F)C(F)(F)F)nc12 |
| InChI | InChI=1S/C10H7F5N2/c1-5-3-2-4-6-7(5)17-8(16-6)9(11,12)10(13,14)15/h2-4H,1H3,(H,16,17) |
| InChIKey | QQXMLYJPGVRBSA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|