About N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide
N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 21362716) has the molecular formula C17H13ClN4O2
and a molecular weight of 340.77 g/mol. Its IUPAC name is N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
| PubChem CID | 21362716 |
| Molecular Formula | C17H13ClN4O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | Cc1cc(CC(=O)Nc2cc(Cl)cc3c2[nH]c2cnccc23)on1 |
| InChI | InChI=1S/C17H13ClN4O2/c1-9-4-11(24-22-9)7-16(23)20-14-6-10(18)5-13-12-2-3-19-8-15(12)21-17(13)14/h2-6,8,21H,7H2,1H3,(H,20,23) |
| InChIKey | TVPTWQPANVVPMI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide?
The IUPAC name of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide (CID 21362716) is N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide.
What is the SMILES notation for N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide?
The canonical SMILES for N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide is Cc1cc(CC(=O)Nc2cc(Cl)cc3c2[nH]c2cnccc23)on1.
What is the InChIKey of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide?
The InChIKey is TVPTWQPANVVPMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN4O2/c1-9-4-11(24-22-9)7-16(23)20-14-6-10(18)5-13-12-2-3-19-8-15(12)21-17(13)14/h2-6,8,21H,7H2,1H3,(H,20,23).
What are the key properties of N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide?
N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide has a molecular weight of 340.77 g/mol, XLogP of 3.85, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-2-(3-methyl-1,2-oxazol-5-yl)acetamide is sourced from PubChem (CID 21362716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).