C18H15ClN4O — CID 89003482
(2E,3Z)-2-(aminomethylidene)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)hexa-3,5-dienamide (PubChem CID 89003482) has the molecular formula C18H15ClN4O and a molecular weight of 338.80 g/mol. Its IUPAC name is (2E,3Z)-2-(aminomethylidene)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)hexa-3,5-dienamide.
| Compound Name | (2E,3Z)-2-(aminomethylidene)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)hexa-3,5-dienamide |
|---|---|
| PubChem CID | 89003482 |
| Molecular Formula | C18H15ClN4O |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (2E,3Z)-2-(aminomethylidene)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)hexa-3,5-dienamide |
| SMILES | C=C/C=C\C(=C/N)C(=O)Nc1cc(Cl)cc2c1[nH]c1cnccc12 |
| InChI | InChI=1S/C18H15ClN4O/c1-2-3-4-11(9-20)18(24)23-15-8-12(19)7-14-13-5-6-21-10-16(13)22-17(14)15/h2-10,22H,1,20H2,(H,23,24)/b4-3-,11-9+ |
| InChIKey | OLRASALUWHZYBF-XOXVZCPUSA-N |
| XLogP | 3.89 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|