C11H6Cl2N2 — CID 22185235
7,9-dichloropyrido[3,4-b]indole (PubChem CID 22185235) has the molecular formula C11H6Cl2N2 and a molecular weight of 237.09 g/mol. Its IUPAC name is 7,9-dichloropyrido[3,4-b]indole.
| Compound Name | 7,9-dichloropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 22185235 |
| Molecular Formula | C11H6Cl2N2 |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 7,9-dichloropyrido[3,4-b]indole |
| SMILES | Clc1ccc2c3ccncc3n(Cl)c2c1 |
| InChI | InChI=1S/C11H6Cl2N2/c12-7-1-2-8-9-3-4-14-6-11(9)15(13)10(8)5-7/h1-6H |
| InChIKey | RZNXOXYOSQIWDC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |