C11H9F3N2O3 — CID 135742363
6,7-dimethoxy-2-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 135742363) has the molecular formula C11H9F3N2O3 and a molecular weight of 274.20 g/mol. Its IUPAC name is 6,7-dimethoxy-2-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 6,7-dimethoxy-2-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135742363 |
| Molecular Formula | C11H9F3N2O3 |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 6,7-dimethoxy-2-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | COc1cc2nc(C(F)(F)F)[nH]c(=O)c2cc1OC |
| InChI | InChI=1S/C11H9F3N2O3/c1-18-7-3-5-6(4-8(7)19-2)15-10(11(12,13)14)16-9(5)17/h3-4H,1-2H3,(H,15,16,17) |
| InChIKey | MOVTXYVMTFUFHJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |