C12H15N3O3 — CID 136951517
2-(ethylamino)-6,7-dimethoxy-3H-quinazolin-4-one (PubChem CID 136951517) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-(ethylamino)-6,7-dimethoxy-3H-quinazolin-4-one.
| Compound Name | 2-(ethylamino)-6,7-dimethoxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136951517 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-(ethylamino)-6,7-dimethoxy-3H-quinazolin-4-one |
| SMILES | CCNc1nc2cc(OC)c(OC)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H15N3O3/c1-4-13-12-14-8-6-10(18-3)9(17-2)5-7(8)11(16)15-12/h5-6H,4H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | YQMQFDDJRMJIPB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |