C16H24N4O3 — CID 137303948
2-[2-(diethylamino)ethylamino]-6,7-dimethoxy-3H-quinazolin-4-one (PubChem CID 137303948) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-6,7-dimethoxy-3H-quinazolin-4-one.
| Compound Name | 2-[2-(diethylamino)ethylamino]-6,7-dimethoxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137303948 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-6,7-dimethoxy-3H-quinazolin-4-one |
| SMILES | CCN(CC)CCNc1nc2cc(OC)c(OC)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H24N4O3/c1-5-20(6-2)8-7-17-16-18-12-10-14(23-4)13(22-3)9-11(12)15(21)19-16/h9-10H,5-8H2,1-4H3,(H2,17,18,19,21) |
| InChIKey | LPJFFHNJDRGPTD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |