C13H17N3O4 — CID 136743156
2-(ethylamino)-5,6,7-trimethoxy-3H-quinazolin-4-one (PubChem CID 136743156) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-(ethylamino)-5,6,7-trimethoxy-3H-quinazolin-4-one.
| Compound Name | 2-(ethylamino)-5,6,7-trimethoxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136743156 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-(ethylamino)-5,6,7-trimethoxy-3H-quinazolin-4-one |
| SMILES | CCNc1nc2cc(OC)c(OC)c(OC)c2c(=O)[nH]1 |
| InChI | InChI=1S/C13H17N3O4/c1-5-14-13-15-7-6-8(18-2)10(19-3)11(20-4)9(7)12(17)16-13/h6H,5H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | IJXSWSFFEKYWQZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |