C14H16ClNO3 — CID 43668765
4-chloro-2-ethyl-5,6,7-trimethoxyquinoline (PubChem CID 43668765) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is 4-chloro-2-ethyl-5,6,7-trimethoxyquinoline.
| Compound Name | 4-chloro-2-ethyl-5,6,7-trimethoxyquinoline |
|---|---|
| PubChem CID | 43668765 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-chloro-2-ethyl-5,6,7-trimethoxyquinoline |
| SMILES | CCc1cc(Cl)c2c(OC)c(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C14H16ClNO3/c1-5-8-6-9(15)12-10(16-8)7-11(17-2)13(18-3)14(12)19-4/h6-7H,5H2,1-4H3 |
| InChIKey | GCAZFYUEUGCXTO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |