C14H16ClNO2 — CID 43668677
4-chloro-6,7-dimethoxy-2-propylquinoline (PubChem CID 43668677) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is 4-chloro-6,7-dimethoxy-2-propylquinoline.
| Compound Name | 4-chloro-6,7-dimethoxy-2-propylquinoline |
|---|---|
| PubChem CID | 43668677 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-chloro-6,7-dimethoxy-2-propylquinoline |
| SMILES | CCCc1cc(Cl)c2cc(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C14H16ClNO2/c1-4-5-9-6-11(15)10-7-13(17-2)14(18-3)8-12(10)16-9/h6-8H,4-5H2,1-3H3 |
| InChIKey | RBXQYZSJDGFICH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |