C15H18ClN — CID 43668449
4-chloro-2,6-dipropylquinoline (PubChem CID 43668449) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is 4-chloro-2,6-dipropylquinoline.
| Compound Name | 4-chloro-2,6-dipropylquinoline |
|---|---|
| PubChem CID | 43668449 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-chloro-2,6-dipropylquinoline |
| SMILES | CCCc1ccc2nc(CCC)cc(Cl)c2c1 |
| InChI | InChI=1S/C15H18ClN/c1-3-5-11-7-8-15-13(9-11)14(16)10-12(17-15)6-4-2/h7-10H,3-6H2,1-2H3 |
| InChIKey | AEOMHUORZIDSQH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |