C16H18ClN — CID 55188071
9-chloro-7-propyl-1,2,3,4-tetrahydroacridine (PubChem CID 55188071) has the molecular formula C16H18ClN and a molecular weight of 259.78 g/mol. Its IUPAC name is 9-chloro-7-propyl-1,2,3,4-tetrahydroacridine.
| Compound Name | 9-chloro-7-propyl-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 55188071 |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 9-chloro-7-propyl-1,2,3,4-tetrahydroacridine |
| SMILES | CCCc1ccc2nc3c(c(Cl)c2c1)CCCC3 |
| InChI | InChI=1S/C16H18ClN/c1-2-5-11-8-9-15-13(10-11)16(17)12-6-3-4-7-14(12)18-15/h8-10H,2-7H2,1H3 |
| InChIKey | YALLBOUIMVFJRH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |