C16H18BrN — CID 82450473
9-(bromomethyl)-7-ethyl-1,2,3,4-tetrahydroacridine (PubChem CID 82450473) has the molecular formula C16H18BrN and a molecular weight of 304.23 g/mol. Its IUPAC name is 9-(bromomethyl)-7-ethyl-1,2,3,4-tetrahydroacridine.
| Compound Name | 9-(bromomethyl)-7-ethyl-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 82450473 |
| Molecular Formula | C16H18BrN |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 9-(bromomethyl)-7-ethyl-1,2,3,4-tetrahydroacridine |
| SMILES | CCc1ccc2nc3c(c(CBr)c2c1)CCCC3 |
| InChI | InChI=1S/C16H18BrN/c1-2-11-7-8-16-13(9-11)14(10-17)12-5-3-4-6-15(12)18-16/h7-9H,2-6,10H2,1H3 |
| InChIKey | RNJZWRDBYVPNPE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|