C13H12BrN — CID 82449852
9-(bromomethyl)-2,3-dihydro-1H-cyclopenta[b]quinoline (PubChem CID 82449852) has the molecular formula C13H12BrN and a molecular weight of 262.15 g/mol. Its IUPAC name is 9-(bromomethyl)-2,3-dihydro-1H-cyclopenta[b]quinoline.
| Compound Name | 9-(bromomethyl)-2,3-dihydro-1H-cyclopenta[b]quinoline |
|---|---|
| PubChem CID | 82449852 |
| Molecular Formula | C13H12BrN |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 9-(bromomethyl)-2,3-dihydro-1H-cyclopenta[b]quinoline |
| SMILES | BrCc1c2c(nc3ccccc13)CCC2 |
| InChI | InChI=1S/C13H12BrN/c14-8-11-9-4-1-2-6-12(9)15-13-7-3-5-10(11)13/h1-2,4,6H,3,5,7-8H2 |
| InChIKey | XJXXLEIHYJIEQN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|