C19H16FN — CID 134913901
9-benzyl-7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline (PubChem CID 134913901) has the molecular formula C19H16FN and a molecular weight of 277.34 g/mol. Its IUPAC name is 9-benzyl-7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline.
| Compound Name | 9-benzyl-7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline |
|---|---|
| PubChem CID | 134913901 |
| Molecular Formula | C19H16FN |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 9-benzyl-7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline |
| SMILES | Fc1ccc2nc3c(c(Cc4ccccc4)c2c1)CCC3 |
| InChI | InChI=1S/C19H16FN/c20-14-9-10-19-17(12-14)16(11-13-5-2-1-3-6-13)15-7-4-8-18(15)21-19/h1-3,5-6,9-10,12H,4,7-8,11H2 |
| InChIKey | ZQCCOTUITOWMRB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |