C19H16ClNO5 — CID 18073587
2-(3-chlorophenyl)-5,6,7-trimethoxyquinoline-4-carboxylic acid (PubChem CID 18073587) has the molecular formula C19H16ClNO5 and a molecular weight of 373.79 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5,6,7-trimethoxyquinoline-4-carboxylic acid.
| Compound Name | 2-(3-chlorophenyl)-5,6,7-trimethoxyquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 18073587 |
| Molecular Formula | C19H16ClNO5 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-(3-chlorophenyl)-5,6,7-trimethoxyquinoline-4-carboxylic acid |
| SMILES | COc1cc2nc(-c3cccc(Cl)c3)cc(C(=O)O)c2c(OC)c1OC |
| InChI | InChI=1S/C19H16ClNO5/c1-24-15-9-14-16(18(26-3)17(15)25-2)12(19(22)23)8-13(21-14)10-5-4-6-11(20)7-10/h4-9H,1-3H3,(H,22,23) |
| InChIKey | XCIRZYIBHKMUPK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |