C13H14ClNO2 — CID 43668808
4-chloro-2-ethyl-6,8-dimethoxyquinoline (PubChem CID 43668808) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 4-chloro-2-ethyl-6,8-dimethoxyquinoline.
| Compound Name | 4-chloro-2-ethyl-6,8-dimethoxyquinoline |
|---|---|
| PubChem CID | 43668808 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 4-chloro-2-ethyl-6,8-dimethoxyquinoline |
| SMILES | CCc1cc(Cl)c2cc(OC)cc(OC)c2n1 |
| InChI | InChI=1S/C13H14ClNO2/c1-4-8-5-11(14)10-6-9(16-2)7-12(17-3)13(10)15-8/h5-7H,4H2,1-3H3 |
| InChIKey | JDELZSAUIBYIMT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |