C15H20N2O2 — CID 82577528
1-(6,8-dimethoxy-4-methylquinolin-2-yl)propan-2-amine (PubChem CID 82577528) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-(6,8-dimethoxy-4-methylquinolin-2-yl)propan-2-amine.
| Compound Name | 1-(6,8-dimethoxy-4-methylquinolin-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 82577528 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-(6,8-dimethoxy-4-methylquinolin-2-yl)propan-2-amine |
| SMILES | COc1cc(OC)c2nc(CC(C)N)cc(C)c2c1 |
| InChI | InChI=1S/C15H20N2O2/c1-9-5-11(6-10(2)16)17-15-13(9)7-12(18-3)8-14(15)19-4/h5,7-8,10H,6,16H2,1-4H3 |
| InChIKey | PZYHJLRWZFMKHI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |