C15H21N3O2 — CID 82248240
2-(aminomethyl)-6,8-dimethoxy-N,N,3-trimethylquinolin-4-amine (PubChem CID 82248240) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(aminomethyl)-6,8-dimethoxy-N,N,3-trimethylquinolin-4-amine.
| Compound Name | 2-(aminomethyl)-6,8-dimethoxy-N,N,3-trimethylquinolin-4-amine |
|---|---|
| PubChem CID | 82248240 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-(aminomethyl)-6,8-dimethoxy-N,N,3-trimethylquinolin-4-amine |
| SMILES | COc1cc(OC)c2nc(CN)c(C)c(N(C)C)c2c1 |
| InChI | InChI=1S/C15H21N3O2/c1-9-12(8-16)17-14-11(15(9)18(2)3)6-10(19-4)7-13(14)20-5/h6-7H,8,16H2,1-5H3 |
| InChIKey | DQJZHDMTGAYDCK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |