C15H16ClNO2 — CID 61382692
9-chloro-5,7-dimethoxy-1,2,3,4-tetrahydroacridine (PubChem CID 61382692) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is 9-chloro-5,7-dimethoxy-1,2,3,4-tetrahydroacridine.
| Compound Name | 9-chloro-5,7-dimethoxy-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 61382692 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 9-chloro-5,7-dimethoxy-1,2,3,4-tetrahydroacridine |
| SMILES | COc1cc(OC)c2nc3c(c(Cl)c2c1)CCCC3 |
| InChI | InChI=1S/C15H16ClNO2/c1-18-9-7-11-14(16)10-5-3-4-6-12(10)17-15(11)13(8-9)19-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | NETQIGJLSNDGEI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |