C16H19ClN2O2 — CID 63479643
7-chloro-5,8-dimethoxy-N-methyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 63479643) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 7-chloro-5,8-dimethoxy-N-methyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 7-chloro-5,8-dimethoxy-N-methyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 63479643 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 7-chloro-5,8-dimethoxy-N-methyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CNc1c2c(nc3c(OC)cc(Cl)c(OC)c13)CCCC2 |
| InChI | InChI=1S/C16H19ClN2O2/c1-18-14-9-6-4-5-7-11(9)19-15-12(20-2)8-10(17)16(21-3)13(14)15/h8H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | BZWLSXSXNAHXAY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |