C13H12ClIN2 — CID 114260954
5-chloro-8-iodo-N-methyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine (PubChem CID 114260954) has the molecular formula C13H12ClIN2 and a molecular weight of 358.61 g/mol. Its IUPAC name is 5-chloro-8-iodo-N-methyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine.
| Compound Name | 5-chloro-8-iodo-N-methyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine |
|---|---|
| PubChem CID | 114260954 |
| Molecular Formula | C13H12ClIN2 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 5-chloro-8-iodo-N-methyl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine |
| SMILES | CNc1c2c(nc3c(Cl)ccc(I)c13)CCC2 |
| InChI | InChI=1S/C13H12ClIN2/c1-16-12-7-3-2-4-10(7)17-13-8(14)5-6-9(15)11(12)13/h5-6H,2-4H2,1H3,(H,16,17) |
| InChIKey | ZRRLPNVXVRDMBE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|