C14H13BrF2N2 — CID 107616780
7-bromo-5,8-difluoro-N-methyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 107616780) has the molecular formula C14H13BrF2N2 and a molecular weight of 327.17 g/mol. Its IUPAC name is 7-bromo-5,8-difluoro-N-methyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 7-bromo-5,8-difluoro-N-methyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 107616780 |
| Molecular Formula | C14H13BrF2N2 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 7-bromo-5,8-difluoro-N-methyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CNc1c2c(nc3c(F)cc(Br)c(F)c13)CCCC2 |
| InChI | InChI=1S/C14H13BrF2N2/c1-18-13-7-4-2-3-5-10(7)19-14-9(16)6-8(15)12(17)11(13)14/h6H,2-5H2,1H3,(H,18,19) |
| InChIKey | WNYLAFMBQUMQQN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|