C14H13N3O5 — CID 133083948
6,7,8-trimethoxy-1H-pyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 133083948) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is 6,7,8-trimethoxy-1H-pyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 6,7,8-trimethoxy-1H-pyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 133083948 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 6,7,8-trimethoxy-1H-pyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | COc1cc2nc3[nH]c(=O)[nH]c(=O)c3cc2c(OC)c1OC |
| InChI | InChI=1S/C14H13N3O5/c1-20-9-5-8-6(10(21-2)11(9)22-3)4-7-12(15-8)16-14(19)17-13(7)18/h4-5H,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | OVNMGQAHRBJIGU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|