C11H14N5O3+ — CID 135449625
diaminomethylidene-(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)azanium (PubChem CID 135449625) has the molecular formula C11H14N5O3+ and a molecular weight of 264.27 g/mol. Its IUPAC name is diaminomethylidene-(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)azanium.
| Compound Name | diaminomethylidene-(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)azanium |
|---|---|
| PubChem CID | 135449625 |
| Molecular Formula | C11H14N5O3+ |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | diaminomethylidene-(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)azanium |
| SMILES | COc1cc2nc([NH+]=C(N)N)[nH]c(=O)c2cc1OC |
| InChI | InChI=1S/C11H13N5O3/c1-18-7-3-5-6(4-8(7)19-2)14-11(15-9(5)17)16-10(12)13/h3-4H,1-2H3,(H5,12,13,14,15,16,17)/p+1 |
| InChIKey | YWLNDYANIWBMAJ-UHFFFAOYSA-O |
| XLogP | -2.07 |
| TPSA | 130.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|