C15H20N4O4S — CID 135729722
(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate (PubChem CID 135729722) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is (6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate.
| Compound Name | (6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate |
|---|---|
| PubChem CID | 135729722 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate |
| SMILES | COCC/N=C(\N)SCc1nc2cc(OC)c(OC)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H20N4O4S/c1-21-5-4-17-15(16)24-8-13-18-10-7-12(23-3)11(22-2)6-9(10)14(20)19-13/h6-7H,4-5,8H2,1-3H3,(H2,16,17)(H,18,19,20) |
| InChIKey | IJKJGTUTMKJIDG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|