C11H14N4O2S2 — CID 136579354
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate (PubChem CID 136579354) has the molecular formula C11H14N4O2S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate.
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate |
|---|---|
| PubChem CID | 136579354 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl N'-(2-methoxyethyl)carbamimidothioate |
| SMILES | COCC/N=C(\N)SCc1nc2ccsc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H14N4O2S2/c1-17-4-3-13-11(12)19-6-8-14-7-2-5-18-9(7)10(16)15-8/h2,5H,3-4,6H2,1H3,(H2,12,13)(H,14,15,16) |
| InChIKey | VVMVAORHIPSXMY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|