C15H18N4O3S — CID 135729701
methyl 4-oxo-2-[(N'-propylcarbamimidoyl)sulfanylmethyl]-3H-quinazoline-7-carboxylate (PubChem CID 135729701) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is methyl 4-oxo-2-[(N'-propylcarbamimidoyl)sulfanylmethyl]-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 4-oxo-2-[(N'-propylcarbamimidoyl)sulfanylmethyl]-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 135729701 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | methyl 4-oxo-2-[(N'-propylcarbamimidoyl)sulfanylmethyl]-3H-quinazoline-7-carboxylate |
| SMILES | CCC/N=C(\N)SCc1nc2cc(C(=O)OC)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H18N4O3S/c1-3-6-17-15(16)23-8-12-18-11-7-9(14(21)22-2)4-5-10(11)13(20)19-12/h4-5,7H,3,6,8H2,1-2H3,(H2,16,17)(H,18,19,20) |
| InChIKey | WKLSOBLGGTUDRI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|