C13H18N2O2S — CID 8775400
methyl 3-[(N'-propylcarbamimidoyl)sulfanylmethyl]benzoate (PubChem CID 8775400) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is methyl 3-[(N'-propylcarbamimidoyl)sulfanylmethyl]benzoate.
| Compound Name | methyl 3-[(N'-propylcarbamimidoyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 8775400 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl 3-[(N'-propylcarbamimidoyl)sulfanylmethyl]benzoate |
| SMILES | CCC/N=C(\N)SCc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C13H18N2O2S/c1-3-7-15-13(14)18-9-10-5-4-6-11(8-10)12(16)17-2/h4-6,8H,3,7,9H2,1-2H3,(H2,14,15) |
| InChIKey | ZMYFPGRRYPUEPZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|