C18H16N4O3S — CID 135729673
methyl 4-oxo-2-[(N'-phenylcarbamimidoyl)sulfanylmethyl]-3H-quinazoline-7-carboxylate (PubChem CID 135729673) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is methyl 4-oxo-2-[(N'-phenylcarbamimidoyl)sulfanylmethyl]-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 4-oxo-2-[(N'-phenylcarbamimidoyl)sulfanylmethyl]-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 135729673 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | methyl 4-oxo-2-[(N'-phenylcarbamimidoyl)sulfanylmethyl]-3H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)[nH]c(CS/C(N)=N/c3ccccc3)nc2c1 |
| InChI | InChI=1S/C18H16N4O3S/c1-25-17(24)11-7-8-13-14(9-11)21-15(22-16(13)23)10-26-18(19)20-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H2,19,20)(H,21,22,23) |
| InChIKey | XPXSITUHKLBXDJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|