C20H28N4O3S — CID 135811872
methyl 2-[[N'-[(2R)-6-methylheptan-2-yl]carbamimidoyl]sulfanylmethyl]-4-oxo-3H-quinazoline-7-carboxylate (PubChem CID 135811872) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is methyl 2-[[N'-[(2R)-6-methylheptan-2-yl]carbamimidoyl]sulfanylmethyl]-4-oxo-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 2-[[N'-[(2R)-6-methylheptan-2-yl]carbamimidoyl]sulfanylmethyl]-4-oxo-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 135811872 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | methyl 2-[[N'-[(2R)-6-methylheptan-2-yl]carbamimidoyl]sulfanylmethyl]-4-oxo-3H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)[nH]c(CS/C(N)=N/[C@H](C)CCCC(C)C)nc2c1 |
| InChI | InChI=1S/C20H28N4O3S/c1-12(2)6-5-7-13(3)22-20(21)28-11-17-23-16-10-14(19(26)27-4)8-9-15(16)18(25)24-17/h8-10,12-13H,5-7,11H2,1-4H3,(H2,21,22)(H,23,24,25)/t13-/m1/s1 |
| InChIKey | VZFZUOQHENXYTA-CYBMUJFWSA-N |
| XLogP | 3.47 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|