C16H16N4O3S — CID 137309525
methyl 2-[(1-ethylimidazol-2-yl)sulfanylmethyl]-4-oxo-3H-quinazoline-7-carboxylate (PubChem CID 137309525) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is methyl 2-[(1-ethylimidazol-2-yl)sulfanylmethyl]-4-oxo-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 2-[(1-ethylimidazol-2-yl)sulfanylmethyl]-4-oxo-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 137309525 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | methyl 2-[(1-ethylimidazol-2-yl)sulfanylmethyl]-4-oxo-3H-quinazoline-7-carboxylate |
| SMILES | CCn1ccnc1SCc1nc2cc(C(=O)OC)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H16N4O3S/c1-3-20-7-6-17-16(20)24-9-13-18-12-8-10(15(22)23-2)4-5-11(12)14(21)19-13/h4-8H,3,9H2,1-2H3,(H,18,19,21) |
| InChIKey | LDNIFOIEQOFUJD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |