C17H11Cl3N2O4 — CID 135887550
methyl 4-oxo-2-[(2,4,5-trichlorophenoxy)methyl]-3H-quinazoline-7-carboxylate (PubChem CID 135887550) has the molecular formula C17H11Cl3N2O4 and a molecular weight of 413.64 g/mol. Its IUPAC name is methyl 4-oxo-2-[(2,4,5-trichlorophenoxy)methyl]-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 4-oxo-2-[(2,4,5-trichlorophenoxy)methyl]-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 135887550 |
| Molecular Formula | C17H11Cl3N2O4 |
| Molecular Weight | 413.64 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | methyl 4-oxo-2-[(2,4,5-trichlorophenoxy)methyl]-3H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)[nH]c(COc3cc(Cl)c(Cl)cc3Cl)nc2c1 |
| InChI | InChI=1S/C17H11Cl3N2O4/c1-25-17(24)8-2-3-9-13(4-8)21-15(22-16(9)23)7-26-14-6-11(19)10(18)5-12(14)20/h2-6H,7H2,1H3,(H,21,22,23) |
| InChIKey | SRMVUCZZOITULV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|