C24H26N2O5 — CID 135814860
methyl 2-[3-(4-tert-butylphenyl)propanoyloxymethyl]-4-oxo-3H-quinazoline-7-carboxylate (PubChem CID 135814860) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is methyl 2-[3-(4-tert-butylphenyl)propanoyloxymethyl]-4-oxo-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 2-[3-(4-tert-butylphenyl)propanoyloxymethyl]-4-oxo-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 135814860 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | methyl 2-[3-(4-tert-butylphenyl)propanoyloxymethyl]-4-oxo-3H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)[nH]c(COC(=O)CCc3ccc(C(C)(C)C)cc3)nc2c1 |
| InChI | InChI=1S/C24H26N2O5/c1-24(2,3)17-9-5-15(6-10-17)7-12-21(27)31-14-20-25-19-13-16(23(29)30-4)8-11-18(19)22(28)26-20/h5-6,8-11,13H,7,12,14H2,1-4H3,(H,25,26,28) |
| InChIKey | MKEWWIFUXHPZMO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |