C17H14N2O6 — CID 135687200
methyl 2-[(3-methylfuran-2-carbonyl)oxymethyl]-4-oxo-3H-quinazoline-7-carboxylate (PubChem CID 135687200) has the molecular formula C17H14N2O6 and a molecular weight of 342.31 g/mol. Its IUPAC name is methyl 2-[(3-methylfuran-2-carbonyl)oxymethyl]-4-oxo-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 2-[(3-methylfuran-2-carbonyl)oxymethyl]-4-oxo-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 135687200 |
| Molecular Formula | C17H14N2O6 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | methyl 2-[(3-methylfuran-2-carbonyl)oxymethyl]-4-oxo-3H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)[nH]c(COC(=O)c3occc3C)nc2c1 |
| InChI | InChI=1S/C17H14N2O6/c1-9-5-6-24-14(9)17(22)25-8-13-18-12-7-10(16(21)23-2)3-4-11(12)15(20)19-13/h3-7H,8H2,1-2H3,(H,18,19,20) |
| InChIKey | RUFOWOLSEJJBNQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |